C23H26F2N2OS — CID 169240184
[2-[3-(difluoromethyl)-2-phenylphenyl]cyclopropyl]-[3-(methylsulfanylamino)piperidin-1-yl]methanone (PubChem CID 169240184) has the molecular formula C23H26F2N2OS and a molecular weight of 416.54 g/mol. Its IUPAC name is [2-[3-(difluoromethyl)-2-phenylphenyl]cyclopropyl]-[3-(methylsulfanylamino)piperidin-1-yl]methanone.
| Compound Name | [2-[3-(difluoromethyl)-2-phenylphenyl]cyclopropyl]-[3-(methylsulfanylamino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 169240184 |
| Molecular Formula | C23H26F2N2OS |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | [2-[3-(difluoromethyl)-2-phenylphenyl]cyclopropyl]-[3-(methylsulfanylamino)piperidin-1-yl]methanone |
| SMILES | CSNC1CCCN(C(=O)C2CC2c2cccc(C(F)F)c2-c2ccccc2)C1 |
| InChI | InChI=1S/C23H26F2N2OS/c1-29-26-16-9-6-12-27(14-16)23(28)20-13-19(20)17-10-5-11-18(22(24)25)21(17)15-7-3-2-4-8-15/h2-5,7-8,10-11,16,19-20,22,26H,6,9,12-14H2,1H3 |
| InChIKey | RQFDTAHVXWGRGX-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|