C20H27FN2OS2 — CID 170294021
[2-[3-(2-fluorophenyl)thiolan-2-yl]cyclopropyl]-[3-(methylsulfanylamino)piperidin-1-yl]methanone (PubChem CID 170294021) has the molecular formula C20H27FN2OS2 and a molecular weight of 394.58 g/mol. Its IUPAC name is [2-[3-(2-fluorophenyl)thiolan-2-yl]cyclopropyl]-[3-(methylsulfanylamino)piperidin-1-yl]methanone.
| Compound Name | [2-[3-(2-fluorophenyl)thiolan-2-yl]cyclopropyl]-[3-(methylsulfanylamino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 170294021 |
| Molecular Formula | C20H27FN2OS2 |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | [2-[3-(2-fluorophenyl)thiolan-2-yl]cyclopropyl]-[3-(methylsulfanylamino)piperidin-1-yl]methanone |
| SMILES | CSNC1CCCN(C(=O)C2CC2C2SCCC2c2ccccc2F)C1 |
| InChI | InChI=1S/C20H27FN2OS2/c1-25-22-13-5-4-9-23(12-13)20(24)17-11-16(17)19-15(8-10-26-19)14-6-2-3-7-18(14)21/h2-3,6-7,13,15-17,19,22H,4-5,8-12H2,1H3 |
| InChIKey | IANBNAKHPZKRJY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|