C22H23F3N2OS — CID 170293763
[2-[2-(2,6-difluorophenyl)-4-fluorophenyl]cyclopropyl]-[3-(methylsulfanylamino)piperidin-1-yl]methanone (PubChem CID 170293763) has the molecular formula C22H23F3N2OS and a molecular weight of 420.50 g/mol. Its IUPAC name is [2-[2-(2,6-difluorophenyl)-4-fluorophenyl]cyclopropyl]-[3-(methylsulfanylamino)piperidin-1-yl]methanone.
| Compound Name | [2-[2-(2,6-difluorophenyl)-4-fluorophenyl]cyclopropyl]-[3-(methylsulfanylamino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 170293763 |
| Molecular Formula | C22H23F3N2OS |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | [2-[2-(2,6-difluorophenyl)-4-fluorophenyl]cyclopropyl]-[3-(methylsulfanylamino)piperidin-1-yl]methanone |
| SMILES | CSNC1CCCN(C(=O)C2CC2c2ccc(F)cc2-c2c(F)cccc2F)C1 |
| InChI | InChI=1S/C22H23F3N2OS/c1-29-26-14-4-3-9-27(12-14)22(28)18-11-16(18)15-8-7-13(23)10-17(15)21-19(24)5-2-6-20(21)25/h2,5-8,10,14,16,18,26H,3-4,9,11-12H2,1H3 |
| InChIKey | SUHREKJDXKRFMR-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|