C22H25FN2OS — CID 169239911
[2-(2-fluoro-6-phenylphenyl)cyclopropyl]-[3-(methylsulfanylamino)piperidin-1-yl]methanone (PubChem CID 169239911) has the molecular formula C22H25FN2OS and a molecular weight of 384.52 g/mol. Its IUPAC name is [2-(2-fluoro-6-phenylphenyl)cyclopropyl]-[3-(methylsulfanylamino)piperidin-1-yl]methanone.
| Compound Name | [2-(2-fluoro-6-phenylphenyl)cyclopropyl]-[3-(methylsulfanylamino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 169239911 |
| Molecular Formula | C22H25FN2OS |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | [2-(2-fluoro-6-phenylphenyl)cyclopropyl]-[3-(methylsulfanylamino)piperidin-1-yl]methanone |
| SMILES | CSNC1CCCN(C(=O)C2CC2c2c(F)cccc2-c2ccccc2)C1 |
| InChI | InChI=1S/C22H25FN2OS/c1-27-24-16-9-6-12-25(14-16)22(26)19-13-18(19)21-17(10-5-11-20(21)23)15-7-3-2-4-8-15/h2-5,7-8,10-11,16,18-19,24H,6,9,12-14H2,1H3 |
| InChIKey | IQPIZKFAIHAEJJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|