C20H24N2OSSi+ — CID 169240147
CID 169240147 (PubChem CID 169240147) has the molecular formula C20H24N2OSSi+ and a molecular weight of 368.58 g/mol.
| Compound Name | CID 169240147 |
|---|---|
| PubChem CID | 169240147 |
| Molecular Formula | C20H24N2OSSi+ |
| Molecular Weight | 368.58 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | — |
| SMILES | C[Si+]NC1CCCN(C(=O)C2CC2c2sccc2-c2ccccc2)C1 |
| InChI | InChI=1S/C20H24N2OSSi/c1-25-21-15-8-5-10-22(13-15)20(23)18-12-17(18)19-16(9-11-24-19)14-6-3-2-4-7-14/h2-4,6-7,9,11,15,17-18,21H,5,8,10,12-13H2,1H3/q+1 |
| InChIKey | UNOYDKUDBQHDGR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.58 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|