C19H32F3NO6S — CID 169240562
dodecyl 2,5-dimethyl-1,2-oxazol-2-ium-4-carboxylate;trifluoromethanesulfonate (PubChem CID 169240562) has the molecular formula C19H32F3NO6S and a molecular weight of 459.53 g/mol. Its IUPAC name is dodecyl 2,5-dimethyl-1,2-oxazol-2-ium-4-carboxylate;trifluoromethanesulfonate.
| Compound Name | dodecyl 2,5-dimethyl-1,2-oxazol-2-ium-4-carboxylate;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 169240562 |
| Molecular Formula | C19H32F3NO6S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | dodecyl 2,5-dimethyl-1,2-oxazol-2-ium-4-carboxylate;trifluoromethanesulfonate |
| SMILES | CCCCCCCCCCCCOC(=O)c1c[n+](C)oc1C.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C18H32NO3.CHF3O3S/c1-4-5-6-7-8-9-10-11-12-13-14-21-18(20)17-15-19(3)22-16(17)2;2-1(3,4)8(5,6)7/h15H,4-14H2,1-3H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | JWVLIRGNIVECML-UHFFFAOYSA-M |
| XLogP | 4.54 |
| TPSA | 100.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|