C14H10N2O2 — CID 169241631
4-(4-hydroxyphenyl)-2H-2,7-naphthyridin-1-one (PubChem CID 169241631) has the molecular formula C14H10N2O2 and a molecular weight of 238.25 g/mol. Its IUPAC name is 4-(4-hydroxyphenyl)-2H-2,7-naphthyridin-1-one.
| Compound Name | 4-(4-hydroxyphenyl)-2H-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 169241631 |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 4-(4-hydroxyphenyl)-2H-2,7-naphthyridin-1-one |
| SMILES | O=c1[nH]cc(-c2ccc(O)cc2)c2ccncc12 |
| InChI | InChI=1S/C14H10N2O2/c17-10-3-1-9(2-4-10)12-8-16-14(18)13-7-15-6-5-11(12)13/h1-8,17H,(H,16,18) |
| InChIKey | MKGVEGNFVUDMBE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |