C26H31N3O6S2 — CID 16924219
ethyl 3-(2-ethoxyethyl)-2-[1-(4-methylphenyl)sulfonylpyrrolidine-2-carbonyl]imino-1,3-benzothiazole-6-carboxylate (PubChem CID 16924219) has the molecular formula C26H31N3O6S2 and a molecular weight of 545.68 g/mol. Its IUPAC name is ethyl 3-(2-ethoxyethyl)-2-[1-(4-methylphenyl)sulfonylpyrrolidine-2-carbonyl]imino-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 3-(2-ethoxyethyl)-2-[1-(4-methylphenyl)sulfonylpyrrolidine-2-carbonyl]imino-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 16924219 |
| Molecular Formula | C26H31N3O6S2 |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | ethyl 3-(2-ethoxyethyl)-2-[1-(4-methylphenyl)sulfonylpyrrolidine-2-carbonyl]imino-1,3-benzothiazole-6-carboxylate |
| SMILES | CCOCCn1/c(=N/C(=O)C2CCCN2S(=O)(=O)c2ccc(C)cc2)sc2cc(C(=O)OCC)ccc21 |
| InChI | InChI=1S/C26H31N3O6S2/c1-4-34-16-15-28-21-13-10-19(25(31)35-5-2)17-23(21)36-26(28)27-24(30)22-7-6-14-29(22)37(32,33)20-11-8-18(3)9-12-20/h8-13,17,22H,4-7,14-16H2,1-3H3/b27-26- |
| InChIKey | SDIMVHBXAHCCIR-RQZHXJHFSA-N |
| XLogP | 3.51 |
| TPSA | 107.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|