C29H28N4O4 — CID 169242310
3-[7-oxo-1'-(quinolin-5-ylmethyl)spiro[2,5-dihydrofuro[2,3-f]isoindole-3,4'-piperidine]-6-yl]piperidine-2,6-dione (PubChem CID 169242310) has the molecular formula C29H28N4O4 and a molecular weight of 496.57 g/mol. Its IUPAC name is 3-[7-oxo-1'-(quinolin-5-ylmethyl)spiro[2,5-dihydrofuro[2,3-f]isoindole-3,4'-piperidine]-6-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-oxo-1'-(quinolin-5-ylmethyl)spiro[2,5-dihydrofuro[2,3-f]isoindole-3,4'-piperidine]-6-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169242310 |
| Molecular Formula | C29H28N4O4 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | 3-[7-oxo-1'-(quinolin-5-ylmethyl)spiro[2,5-dihydrofuro[2,3-f]isoindole-3,4'-piperidine]-6-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc4c(cc3C2=O)OCC42CCN(Cc3cccc4ncccc34)CC2)C(=O)N1 |
| InChI | InChI=1S/C29H28N4O4/c34-26-7-6-24(27(35)31-26)33-16-19-13-22-25(14-21(19)28(33)36)37-17-29(22)8-11-32(12-9-29)15-18-3-1-5-23-20(18)4-2-10-30-23/h1-5,10,13-14,24H,6-9,11-12,15-17H2,(H,31,34,35) |
| InChIKey | BYXGDQGNHDHMBF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|