C31H35N3O5 — CID 169242357
3-[1'-[(2,2-dimethyl-3,4-dihydrochromen-8-yl)methyl]-7-oxospiro[2,5-dihydrofuro[2,3-f]isoindole-3,4'-piperidine]-6-yl]piperidine-2,6-dione (PubChem CID 169242357) has the molecular formula C31H35N3O5 and a molecular weight of 529.64 g/mol. Its IUPAC name is 3-[1'-[(2,2-dimethyl-3,4-dihydrochromen-8-yl)methyl]-7-oxospiro[2,5-dihydrofuro[2,3-f]isoindole-3,4'-piperidine]-6-yl]piperidine-2,6-dione.
| Compound Name | 3-[1'-[(2,2-dimethyl-3,4-dihydrochromen-8-yl)methyl]-7-oxospiro[2,5-dihydrofuro[2,3-f]isoindole-3,4'-piperidine]-6-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169242357 |
| Molecular Formula | C31H35N3O5 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.26 |
| IUPAC Name | 3-[1'-[(2,2-dimethyl-3,4-dihydrochromen-8-yl)methyl]-7-oxospiro[2,5-dihydrofuro[2,3-f]isoindole-3,4'-piperidine]-6-yl]piperidine-2,6-dione |
| SMILES | CC1(C)CCc2cccc(CN3CCC4(CC3)COc3cc5c(cc34)CN(C3CCC(=O)NC3=O)C5=O)c2O1 |
| InChI | InChI=1S/C31H35N3O5/c1-30(2)9-8-19-4-3-5-20(27(19)39-30)16-33-12-10-31(11-13-33)18-38-25-15-22-21(14-23(25)31)17-34(29(22)37)24-6-7-26(35)32-28(24)36/h3-5,14-15,24H,6-13,16-18H2,1-2H3,(H,32,35,36) |
| InChIKey | WFEFIODCDLPMPM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|