C28H28N4O4 — CID 169242371
3-[1'-(1H-indol-7-ylmethyl)-7-oxospiro[2,5-dihydrofuro[2,3-f]isoindole-3,4'-piperidine]-6-yl]piperidine-2,6-dione (PubChem CID 169242371) has the molecular formula C28H28N4O4 and a molecular weight of 484.56 g/mol. Its IUPAC name is 3-[1'-(1H-indol-7-ylmethyl)-7-oxospiro[2,5-dihydrofuro[2,3-f]isoindole-3,4'-piperidine]-6-yl]piperidine-2,6-dione.
| Compound Name | 3-[1'-(1H-indol-7-ylmethyl)-7-oxospiro[2,5-dihydrofuro[2,3-f]isoindole-3,4'-piperidine]-6-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169242371 |
| Molecular Formula | C28H28N4O4 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 3-[1'-(1H-indol-7-ylmethyl)-7-oxospiro[2,5-dihydrofuro[2,3-f]isoindole-3,4'-piperidine]-6-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc4c(cc3C2=O)OCC42CCN(Cc3cccc4cc[nH]c34)CC2)C(=O)N1 |
| InChI | InChI=1S/C28H28N4O4/c33-24-5-4-22(26(34)30-24)32-15-19-12-21-23(13-20(19)27(32)35)36-16-28(21)7-10-31(11-8-28)14-18-3-1-2-17-6-9-29-25(17)18/h1-3,6,9,12-13,22,29H,4-5,7-8,10-11,14-16H2,(H,30,33,34) |
| InChIKey | HGNARAPRCHOEKL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 94.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|