C30H60OP+ — CID 169243392
ethane;methanol;tributyl-[[4-(2,2,4-trimethylpentan-3-yl)phenyl]methyl]phosphanium (PubChem CID 169243392) has the molecular formula C30H60OP+ and a molecular weight of 467.78 g/mol. Its IUPAC name is ethane;methanol;tributyl-[[4-(2,2,4-trimethylpentan-3-yl)phenyl]methyl]phosphanium.
| Compound Name | ethane;methanol;tributyl-[[4-(2,2,4-trimethylpentan-3-yl)phenyl]methyl]phosphanium |
|---|---|
| PubChem CID | 169243392 |
| Molecular Formula | C30H60OP+ |
| Molecular Weight | 467.78 g/mol |
| Exact Mass | 467.44 |
| IUPAC Name | ethane;methanol;tributyl-[[4-(2,2,4-trimethylpentan-3-yl)phenyl]methyl]phosphanium |
| SMILES | CC.CCCC[P+](CCCC)(CCCC)Cc1ccc(C(C(C)C)C(C)(C)C)cc1.CO |
| InChI | InChI=1S/C27H50P.C2H6.CH4O/c1-9-12-19-28(20-13-10-2,21-14-11-3)22-24-15-17-25(18-16-24)26(23(4)5)27(6,7)8;2*1-2/h15-18,23,26H,9-14,19-22H2,1-8H3;1-2H3;2H,1H3/q+1;; |
| InChIKey | HZFGKOFANQGVAS-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.78 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|