C7H12N2O — CID 169243513
[2-(aminomethyl)-1,2-dihydropyridin-5-yl]methanol (PubChem CID 169243513) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is [2-(aminomethyl)-1,2-dihydropyridin-5-yl]methanol.
| Compound Name | [2-(aminomethyl)-1,2-dihydropyridin-5-yl]methanol |
|---|---|
| PubChem CID | 169243513 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | [2-(aminomethyl)-1,2-dihydropyridin-5-yl]methanol |
| SMILES | NCC1C=CC(CO)=CN1 |
| InChI | InChI=1S/C7H12N2O/c8-3-7-2-1-6(5-10)4-9-7/h1-2,4,7,9-10H,3,5,8H2 |
| InChIKey | KYOKOLCXZYYSJG-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |