C10H26N2O — CID 169244569
2-ethyl-N-methyl-2-(propan-2-ylamino)butanamide;molecular hydrogen (PubChem CID 169244569) has the molecular formula C10H26N2O and a molecular weight of 190.33 g/mol. Its IUPAC name is 2-ethyl-N-methyl-2-(propan-2-ylamino)butanamide;molecular hydrogen.
| Compound Name | 2-ethyl-N-methyl-2-(propan-2-ylamino)butanamide;molecular hydrogen |
|---|---|
| PubChem CID | 169244569 |
| Molecular Formula | C10H26N2O |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.20 |
| IUPAC Name | 2-ethyl-N-methyl-2-(propan-2-ylamino)butanamide;molecular hydrogen |
| SMILES | CCC(CC)(NC(C)C)C(=O)NC.[H][H].[H][H] |
| InChI | InChI=1S/C10H22N2O.2H2/c1-6-10(7-2,9(13)11-5)12-8(3)4;;/h8,12H,6-7H2,1-5H3,(H,11,13);2*1H |
| InChIKey | NBOIESQFLJSOFM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |