C9H20N2O3 — CID 45120258
2-acetamido-2-ethyl-N-methylbutanamide;hydrate (PubChem CID 45120258) has the molecular formula C9H20N2O3 and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-acetamido-2-ethyl-N-methylbutanamide;hydrate.
| Compound Name | 2-acetamido-2-ethyl-N-methylbutanamide;hydrate |
|---|---|
| PubChem CID | 45120258 |
| Molecular Formula | C9H20N2O3 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 2-acetamido-2-ethyl-N-methylbutanamide;hydrate |
| SMILES | CCC(CC)(NC(C)=O)C(=O)NC.O |
| InChI | InChI=1S/C9H18N2O2.H2O/c1-5-9(6-2,8(13)10-4)11-7(3)12;/h5-6H2,1-4H3,(H,10,13)(H,11,12);1H2 |
| InChIKey | XEWYYLRBFSGKFG-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |