C16H20N2O — CID 169245298
2-(1-cyclopropylidene-1-ethoxypropan-2-yl)-7-methylimidazo[1,2-a]pyridine (PubChem CID 169245298) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 2-(1-cyclopropylidene-1-ethoxypropan-2-yl)-7-methylimidazo[1,2-a]pyridine.
| Compound Name | 2-(1-cyclopropylidene-1-ethoxypropan-2-yl)-7-methylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 169245298 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 2-(1-cyclopropylidene-1-ethoxypropan-2-yl)-7-methylimidazo[1,2-a]pyridine |
| SMILES | CCOC(=C1CC1)C(C)c1cn2ccc(C)cc2n1 |
| InChI | InChI=1S/C16H20N2O/c1-4-19-16(13-5-6-13)12(3)14-10-18-8-7-11(2)9-15(18)17-14/h7-10,12H,4-6H2,1-3H3 |
| InChIKey | MEOKHIKEDHEXOC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|