C25H36N4O4S — CID 169246901
(11S,14S)-4-ethyl-14-(5-sulfanylpentyl)-4,7,13,16-tetrazatricyclo[16.3.1.07,11]docosa-1(22),18,20-triene-3,6,12,15-tetrone (PubChem CID 169246901) has the molecular formula C25H36N4O4S and a molecular weight of 488.65 g/mol. Its IUPAC name is (11S,14S)-4-ethyl-14-(5-sulfanylpentyl)-4,7,13,16-tetrazatricyclo[16.3.1.07,11]docosa-1(22),18,20-triene-3,6,12,15-tetrone.
| Compound Name | (11S,14S)-4-ethyl-14-(5-sulfanylpentyl)-4,7,13,16-tetrazatricyclo[16.3.1.07,11]docosa-1(22),18,20-triene-3,6,12,15-tetrone |
|---|---|
| PubChem CID | 169246901 |
| Molecular Formula | C25H36N4O4S |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | (11S,14S)-4-ethyl-14-(5-sulfanylpentyl)-4,7,13,16-tetrazatricyclo[16.3.1.07,11]docosa-1(22),18,20-triene-3,6,12,15-tetrone |
| SMILES | CCN1CC(=O)N2CCC[C@H]2C(=O)N[C@@H](CCCCCS)C(=O)NCc2cccc(c2)CC1=O |
| InChI | InChI=1S/C25H36N4O4S/c1-2-28-17-23(31)29-12-7-11-21(29)25(33)27-20(10-4-3-5-13-34)24(32)26-16-19-9-6-8-18(14-19)15-22(28)30/h6,8-9,14,20-21,34H,2-5,7,10-13,15-17H2,1H3,(H,26,32)(H,27,33)/t20-,21-/m0/s1 |
| InChIKey | BUFKHZCCUZPVDX-SFTDATJTSA-N |
| XLogP | 1.67 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|