C31H38N4O4S — CID 169246915
(13S,19R,22S)-22-(5-sulfanylpentyl)-4,15,21,24-tetrazapentacyclo[24.3.1.04,13.07,12.015,19]triaconta-1(30),7,9,11,26,28-hexaene-3,14,20,23-tetrone (PubChem CID 169246915) has the molecular formula C31H38N4O4S and a molecular weight of 562.74 g/mol. Its IUPAC name is (13S,19R,22S)-22-(5-sulfanylpentyl)-4,15,21,24-tetrazapentacyclo[24.3.1.04,13.07,12.015,19]triaconta-1(30),7,9,11,26,28-hexaene-3,14,20,23-tetrone.
| Compound Name | (13S,19R,22S)-22-(5-sulfanylpentyl)-4,15,21,24-tetrazapentacyclo[24.3.1.04,13.07,12.015,19]triaconta-1(30),7,9,11,26,28-hexaene-3,14,20,23-tetrone |
|---|---|
| PubChem CID | 169246915 |
| Molecular Formula | C31H38N4O4S |
| Molecular Weight | 562.74 g/mol |
| Exact Mass | 562.26 |
| IUPAC Name | (13S,19R,22S)-22-(5-sulfanylpentyl)-4,15,21,24-tetrazapentacyclo[24.3.1.04,13.07,12.015,19]triaconta-1(30),7,9,11,26,28-hexaene-3,14,20,23-tetrone |
| SMILES | O=C1NCc2cccc(c2)CC(=O)N2CCc3ccccc3[C@H]2C(=O)N2CCC[C@@H]2C(=O)N[C@H]1CCCCCS |
| InChI | InChI=1S/C31H38N4O4S/c36-27-19-21-8-6-9-22(18-21)20-32-29(37)25(12-2-1-5-17-40)33-30(38)26-13-7-15-34(26)31(39)28-24-11-4-3-10-23(24)14-16-35(27)28/h3-4,6,8-11,18,25-26,28,40H,1-2,5,7,12-17,19-20H2,(H,32,37)(H,33,38)/t25-,26+,28-/m0/s1 |
| InChIKey | HYFDJBNYYLLTEZ-REUBFRLUSA-N |
| XLogP | 2.95 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.74 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|