C26H46N2O6S — CID 169247082
2-methylpropane;N-[(6Z)-11,12,13-trihydroxy-8-methyl-14-oxa-2-thiabicyclo[8.3.1]tetradec-6-en-9-yl]-3,4,5,5a,6,7,8,8a-octahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide (PubChem CID 169247082) has the molecular formula C26H46N2O6S and a molecular weight of 514.73 g/mol. Its IUPAC name is 2-methylpropane;N-[(6Z)-11,12,13-trihydroxy-8-methyl-14-oxa-2-thiabicyclo[8.3.1]tetradec-6-en-9-yl]-3,4,5,5a,6,7,8,8a-octahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide.
| Compound Name | 2-methylpropane;N-[(6Z)-11,12,13-trihydroxy-8-methyl-14-oxa-2-thiabicyclo[8.3.1]tetradec-6-en-9-yl]-3,4,5,5a,6,7,8,8a-octahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide |
|---|---|
| PubChem CID | 169247082 |
| Molecular Formula | C26H46N2O6S |
| Molecular Weight | 514.73 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | 2-methylpropane;N-[(6Z)-11,12,13-trihydroxy-8-methyl-14-oxa-2-thiabicyclo[8.3.1]tetradec-6-en-9-yl]-3,4,5,5a,6,7,8,8a-octahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide |
| SMILES | CC(C)C.CC1/C=C\CCCSC2OC(C(O)C(O)C2O)C1NC(=O)C1NCC2CCCCOC21 |
| InChI | InChI=1S/C22H36N2O6S.C4H10/c1-12-7-3-2-6-10-31-22-18(27)16(25)17(26)20(30-22)14(12)24-21(28)15-19-13(11-23-15)8-4-5-9-29-19;1-4(2)3/h3,7,12-20,22-23,25-27H,2,4-6,8-11H2,1H3,(H,24,28);4H,1-3H3/b7-3-; |
| InChIKey | CHCXBOPGRHLMIP-WYLUAFJRSA-N |
| XLogP | 1.82 |
| TPSA | 120.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.73 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|