C21H34N2O6S — CID 170359814
N-[(5Z)-10,11,12-trihydroxy-7-methyl-13-oxa-2-thiabicyclo[7.3.1]tridec-5-en-8-yl]-3,4,5,5a,6,7,8,8a-octahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide (PubChem CID 170359814) has the molecular formula C21H34N2O6S and a molecular weight of 442.58 g/mol. Its IUPAC name is N-[(5Z)-10,11,12-trihydroxy-7-methyl-13-oxa-2-thiabicyclo[7.3.1]tridec-5-en-8-yl]-3,4,5,5a,6,7,8,8a-octahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide.
| Compound Name | N-[(5Z)-10,11,12-trihydroxy-7-methyl-13-oxa-2-thiabicyclo[7.3.1]tridec-5-en-8-yl]-3,4,5,5a,6,7,8,8a-octahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide |
|---|---|
| PubChem CID | 170359814 |
| Molecular Formula | C21H34N2O6S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | N-[(5Z)-10,11,12-trihydroxy-7-methyl-13-oxa-2-thiabicyclo[7.3.1]tridec-5-en-8-yl]-3,4,5,5a,6,7,8,8a-octahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide |
| SMILES | CC1/C=C\CCSC2OC(C(O)C(O)C2O)C1NC(=O)C1NCC2CCCCOC21 |
| InChI | InChI=1S/C21H34N2O6S/c1-11-6-3-5-9-30-21-17(26)15(24)16(25)19(29-21)13(11)23-20(27)14-18-12(10-22-14)7-2-4-8-28-18/h3,6,11-19,21-22,24-26H,2,4-5,7-10H2,1H3,(H,23,27)/b6-3- |
| InChIKey | HNVQRBCDVYZIBB-UTCJRWHESA-N |
| XLogP | -0.23 |
| TPSA | 120.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|