C25H41N3O7S — CID 170361754
N-[(5Z,8R)-10,11,12-trihydroxy-3-(morpholin-4-ylmethyl)-13-oxa-2-thiabicyclo[7.3.1]tridec-5-en-8-yl]-3,4,5,5a,6,7,8,8a-octahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide (PubChem CID 170361754) has the molecular formula C25H41N3O7S and a molecular weight of 527.68 g/mol. Its IUPAC name is N-[(5Z,8R)-10,11,12-trihydroxy-3-(morpholin-4-ylmethyl)-13-oxa-2-thiabicyclo[7.3.1]tridec-5-en-8-yl]-3,4,5,5a,6,7,8,8a-octahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide.
| Compound Name | N-[(5Z,8R)-10,11,12-trihydroxy-3-(morpholin-4-ylmethyl)-13-oxa-2-thiabicyclo[7.3.1]tridec-5-en-8-yl]-3,4,5,5a,6,7,8,8a-octahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide |
|---|---|
| PubChem CID | 170361754 |
| Molecular Formula | C25H41N3O7S |
| Molecular Weight | 527.68 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | N-[(5Z,8R)-10,11,12-trihydroxy-3-(morpholin-4-ylmethyl)-13-oxa-2-thiabicyclo[7.3.1]tridec-5-en-8-yl]-3,4,5,5a,6,7,8,8a-octahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide |
| SMILES | O=C(N[C@@H]1C/C=C\CC(CN2CCOCC2)SC2OC1C(O)C(O)C2O)C1NCC2CCCCOC21 |
| InChI | InChI=1S/C25H41N3O7S/c29-19-20(30)23-17(27-24(32)18-22-15(13-26-18)5-3-4-10-34-22)7-2-1-6-16(36-25(35-23)21(19)31)14-28-8-11-33-12-9-28/h1-2,15-23,25-26,29-31H,3-14H2,(H,27,32)/b2-1-/t15?,16?,17-,18?,19?,20?,21?,22?,23?,25?/m1/s1 |
| InChIKey | OWTPQGBABOGNLJ-NONISDBMSA-N |
| XLogP | -0.78 |
| TPSA | 132.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.68 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|