C23H48N4O3 — CID 169248883
3-[[(Z)-8-acetamido-2,7,7-trimethyl-9-oxodec-4-en-2-yl]amino]-2-(methylamino)propanamide;ethane (PubChem CID 169248883) has the molecular formula C23H48N4O3 and a molecular weight of 428.66 g/mol. Its IUPAC name is 3-[[(Z)-8-acetamido-2,7,7-trimethyl-9-oxodec-4-en-2-yl]amino]-2-(methylamino)propanamide;ethane.
| Compound Name | 3-[[(Z)-8-acetamido-2,7,7-trimethyl-9-oxodec-4-en-2-yl]amino]-2-(methylamino)propanamide;ethane |
|---|---|
| PubChem CID | 169248883 |
| Molecular Formula | C23H48N4O3 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.37 |
| IUPAC Name | 3-[[(Z)-8-acetamido-2,7,7-trimethyl-9-oxodec-4-en-2-yl]amino]-2-(methylamino)propanamide;ethane |
| SMILES | CC.CC.CNC(CNC(C)(C)C/C=C\CC(C)(C)C(NC(C)=O)C(C)=O)C(N)=O |
| InChI | InChI=1S/C19H36N4O3.2C2H6/c1-13(24)16(23-14(2)25)18(3,4)10-8-9-11-19(5,6)22-12-15(21-7)17(20)26;2*1-2/h8-9,15-16,21-22H,10-12H2,1-7H3,(H2,20,26)(H,23,25);2*1-2H3/b9-8-;; |
| InChIKey | LQJSPGIOFJDSQS-ULDSSAIZSA-N |
| XLogP | 2.94 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|