C14H19BF2N2O2 — CID 169249013
[4-cyclohexyl-2-(3,3-difluorocyclobutyl)pyrimidin-5-yl]boronic acid (PubChem CID 169249013) has the molecular formula C14H19BF2N2O2 and a molecular weight of 296.13 g/mol. Its IUPAC name is [4-cyclohexyl-2-(3,3-difluorocyclobutyl)pyrimidin-5-yl]boronic acid.
| Compound Name | [4-cyclohexyl-2-(3,3-difluorocyclobutyl)pyrimidin-5-yl]boronic acid |
|---|---|
| PubChem CID | 169249013 |
| Molecular Formula | C14H19BF2N2O2 |
| Molecular Weight | 296.13 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | [4-cyclohexyl-2-(3,3-difluorocyclobutyl)pyrimidin-5-yl]boronic acid |
| SMILES | OB(O)c1cnc(C2CC(F)(F)C2)nc1C1CCCCC1 |
| InChI | InChI=1S/C14H19BF2N2O2/c16-14(17)6-10(7-14)13-18-8-11(15(20)21)12(19-13)9-4-2-1-3-5-9/h8-10,20-21H,1-7H2 |
| InChIKey | YUQRHJWNHBUJAV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.13 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|