C15H20BF2NO2 — CID 169249563
[4-cyclohexyl-6-(3,3-difluorocyclobutyl)-3-pyridinyl]boronic acid (PubChem CID 169249563) has the molecular formula C15H20BF2NO2 and a molecular weight of 295.14 g/mol. Its IUPAC name is [4-cyclohexyl-6-(3,3-difluorocyclobutyl)-3-pyridinyl]boronic acid.
| Compound Name | [4-cyclohexyl-6-(3,3-difluorocyclobutyl)-3-pyridinyl]boronic acid |
|---|---|
| PubChem CID | 169249563 |
| Molecular Formula | C15H20BF2NO2 |
| Molecular Weight | 295.14 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | [4-cyclohexyl-6-(3,3-difluorocyclobutyl)-3-pyridinyl]boronic acid |
| SMILES | OB(O)c1cnc(C2CC(F)(F)C2)cc1C1CCCCC1 |
| InChI | InChI=1S/C15H20BF2NO2/c17-15(18)7-11(8-15)14-6-12(10-4-2-1-3-5-10)13(9-19-14)16(20)21/h6,9-11,20-21H,1-5,7-8H2 |
| InChIKey | KOKRGJUMDCZWIA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.14 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|