C8H8ClN5 — CID 169253829
6-chloro-2-(4-methyl-1,2,4-triazol-3-yl)pyridin-3-amine (PubChem CID 169253829) has the molecular formula C8H8ClN5 and a molecular weight of 209.64 g/mol. Its IUPAC name is 6-chloro-2-(4-methyl-1,2,4-triazol-3-yl)pyridin-3-amine.
| Compound Name | 6-chloro-2-(4-methyl-1,2,4-triazol-3-yl)pyridin-3-amine |
|---|---|
| PubChem CID | 169253829 |
| Molecular Formula | C8H8ClN5 |
| Molecular Weight | 209.64 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 6-chloro-2-(4-methyl-1,2,4-triazol-3-yl)pyridin-3-amine |
| SMILES | Cn1cnnc1-c1nc(Cl)ccc1N |
| InChI | InChI=1S/C8H8ClN5/c1-14-4-11-13-8(14)7-5(10)2-3-6(9)12-7/h2-4H,10H2,1H3 |
| InChIKey | NLKNPTKIGRHZCT-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.64 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|