C14H10ClFN4 — CID 166556278
2-chloro-4-[4-fluoro-2-(4-methyl-1,2,4-triazol-3-yl)phenyl]pyridine (PubChem CID 166556278) has the molecular formula C14H10ClFN4 and a molecular weight of 288.71 g/mol. Its IUPAC name is 2-chloro-4-[4-fluoro-2-(4-methyl-1,2,4-triazol-3-yl)phenyl]pyridine.
| Compound Name | 2-chloro-4-[4-fluoro-2-(4-methyl-1,2,4-triazol-3-yl)phenyl]pyridine |
|---|---|
| PubChem CID | 166556278 |
| Molecular Formula | C14H10ClFN4 |
| Molecular Weight | 288.71 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 2-chloro-4-[4-fluoro-2-(4-methyl-1,2,4-triazol-3-yl)phenyl]pyridine |
| SMILES | Cn1cnnc1-c1cc(F)ccc1-c1ccnc(Cl)c1 |
| InChI | InChI=1S/C14H10ClFN4/c1-20-8-18-19-14(20)12-7-10(16)2-3-11(12)9-4-5-17-13(15)6-9/h2-8H,1H3 |
| InChIKey | ZRNQRICLNHHGNA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.71 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|