C18H15FN6O — CID 171820455
3-[[4-[4-fluoro-2-(4-methyl-1,2,4-triazol-3-yl)phenyl]-6-formyl-2-pyridinyl]amino]propanenitrile (PubChem CID 171820455) has the molecular formula C18H15FN6O and a molecular weight of 350.36 g/mol. Its IUPAC name is 3-[[4-[4-fluoro-2-(4-methyl-1,2,4-triazol-3-yl)phenyl]-6-formyl-2-pyridinyl]amino]propanenitrile.
| Compound Name | 3-[[4-[4-fluoro-2-(4-methyl-1,2,4-triazol-3-yl)phenyl]-6-formyl-2-pyridinyl]amino]propanenitrile |
|---|---|
| PubChem CID | 171820455 |
| Molecular Formula | C18H15FN6O |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 3-[[4-[4-fluoro-2-(4-methyl-1,2,4-triazol-3-yl)phenyl]-6-formyl-2-pyridinyl]amino]propanenitrile |
| SMILES | Cn1cnnc1-c1cc(F)ccc1-c1cc(C=O)nc(NCCC#N)c1 |
| InChI | InChI=1S/C18H15FN6O/c1-25-11-22-24-18(25)16-9-13(19)3-4-15(16)12-7-14(10-26)23-17(8-12)21-6-2-5-20/h3-4,7-11H,2,6H2,1H3,(H,21,23) |
| InChIKey | UUFZGXWZTBSRNH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|