C19H15ClN6 — CID 171820453
3-[2-(but-3-ynylamino)-6-chloro-4-pyridinyl]-4-(4-methyl-1,2,4-triazol-3-yl)benzonitrile (PubChem CID 171820453) has the molecular formula C19H15ClN6 and a molecular weight of 362.82 g/mol. Its IUPAC name is 3-[2-(but-3-ynylamino)-6-chloro-4-pyridinyl]-4-(4-methyl-1,2,4-triazol-3-yl)benzonitrile.
| Compound Name | 3-[2-(but-3-ynylamino)-6-chloro-4-pyridinyl]-4-(4-methyl-1,2,4-triazol-3-yl)benzonitrile |
|---|---|
| PubChem CID | 171820453 |
| Molecular Formula | C19H15ClN6 |
| Molecular Weight | 362.82 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 3-[2-(but-3-ynylamino)-6-chloro-4-pyridinyl]-4-(4-methyl-1,2,4-triazol-3-yl)benzonitrile |
| SMILES | C#CCCNc1cc(-c2cc(C#N)ccc2-c2nncn2C)cc(Cl)n1 |
| InChI | InChI=1S/C19H15ClN6/c1-3-4-7-22-18-10-14(9-17(20)24-18)16-8-13(11-21)5-6-15(16)19-25-23-12-26(19)2/h1,5-6,8-10,12H,4,7H2,2H3,(H,22,24) |
| InChIKey | AQLQMRDJHYRCOC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.82 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|