C18H15FN6O2 — CID 171820382
6-(2-cyanoethylamino)-4-[4-fluoro-2-(4-methyl-1,2,4-triazol-3-yl)phenyl]pyridine-2-carboxylic acid (PubChem CID 171820382) has the molecular formula C18H15FN6O2 and a molecular weight of 366.36 g/mol. Its IUPAC name is 6-(2-cyanoethylamino)-4-[4-fluoro-2-(4-methyl-1,2,4-triazol-3-yl)phenyl]pyridine-2-carboxylic acid.
| Compound Name | 6-(2-cyanoethylamino)-4-[4-fluoro-2-(4-methyl-1,2,4-triazol-3-yl)phenyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 171820382 |
| Molecular Formula | C18H15FN6O2 |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 6-(2-cyanoethylamino)-4-[4-fluoro-2-(4-methyl-1,2,4-triazol-3-yl)phenyl]pyridine-2-carboxylic acid |
| SMILES | Cn1cnnc1-c1cc(F)ccc1-c1cc(NCCC#N)nc(C(=O)O)c1 |
| InChI | InChI=1S/C18H15FN6O2/c1-25-10-22-24-17(25)14-9-12(19)3-4-13(14)11-7-15(18(26)27)23-16(8-11)21-6-2-5-20/h3-4,7-10H,2,6H2,1H3,(H,21,23)(H,26,27) |
| InChIKey | WTPVASBJGONXHH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|