C16H16ClN5 — CID 167421238
6-chloro-N,N-dimethyl-4-[2-(4-methyl-1,2,4-triazol-3-yl)phenyl]pyridin-2-amine (PubChem CID 167421238) has the molecular formula C16H16ClN5 and a molecular weight of 313.79 g/mol. Its IUPAC name is 6-chloro-N,N-dimethyl-4-[2-(4-methyl-1,2,4-triazol-3-yl)phenyl]pyridin-2-amine.
| Compound Name | 6-chloro-N,N-dimethyl-4-[2-(4-methyl-1,2,4-triazol-3-yl)phenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 167421238 |
| Molecular Formula | C16H16ClN5 |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 6-chloro-N,N-dimethyl-4-[2-(4-methyl-1,2,4-triazol-3-yl)phenyl]pyridin-2-amine |
| SMILES | CN(C)c1cc(-c2ccccc2-c2nncn2C)cc(Cl)n1 |
| InChI | InChI=1S/C16H16ClN5/c1-21(2)15-9-11(8-14(17)19-15)12-6-4-5-7-13(12)16-20-18-10-22(16)3/h4-10H,1-3H3 |
| InChIKey | ODNPOHZBOMSEOM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|