About CID 169256629
CID 169256629 (PubChem CID 169256629) has the molecular formula C9H3B2BrClF3O
and a molecular weight of 321.10 g/mol.
Molecular Properties
| Compound Name | CID 169256629 |
| PubChem CID | 169256629 |
| Molecular Formula | C9H3B2BrClF3O |
| Molecular Weight | 321.10 g/mol |
| Exact Mass | 319.92 |
| IUPAC Name | — |
| SMILES | [B]c1c(Cl)c(C(=O)C(F)(F)F)c([B])c(C)c1Br |
| InChI | InChI=1S/C9H3B2BrClF3O/c1-2-4(10)3(8(17)9(14,15)16)7(13)5(11)6(2)12/h1H3 |
| InChIKey | OJXPBNSASCVOAK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.10 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 169256629 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 169256629?
The IUPAC name of CID 169256629 (CID 169256629) is not available.
What is the SMILES notation for CID 169256629?
The canonical SMILES for CID 169256629 is [B]c1c(Cl)c(C(=O)C(F)(F)F)c([B])c(C)c1Br.
What is the InChIKey of CID 169256629?
The InChIKey is OJXPBNSASCVOAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H3B2BrClF3O/c1-2-4(10)3(8(17)9(14,15)16)7(13)5(11)6(2)12/h1H3.
What are the key properties of CID 169256629?
CID 169256629 has a molecular weight of 321.10 g/mol, XLogP of 1.74, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 169256629 is sourced from PubChem (CID 169256629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).