C29H45FN4OS — CID 169258032
5-[9-[[4-(4-aminopiperidin-1-yl)sulfanylpiperidin-1-yl]methyl]-3-azaspiro[5.5]undecan-3-yl]-4-fluoro-2-methylbenzaldehyde (PubChem CID 169258032) has the molecular formula C29H45FN4OS and a molecular weight of 516.77 g/mol. Its IUPAC name is 5-[9-[[4-(4-aminopiperidin-1-yl)sulfanylpiperidin-1-yl]methyl]-3-azaspiro[5.5]undecan-3-yl]-4-fluoro-2-methylbenzaldehyde.
| Compound Name | 5-[9-[[4-(4-aminopiperidin-1-yl)sulfanylpiperidin-1-yl]methyl]-3-azaspiro[5.5]undecan-3-yl]-4-fluoro-2-methylbenzaldehyde |
|---|---|
| PubChem CID | 169258032 |
| Molecular Formula | C29H45FN4OS |
| Molecular Weight | 516.77 g/mol |
| Exact Mass | 516.33 |
| IUPAC Name | 5-[9-[[4-(4-aminopiperidin-1-yl)sulfanylpiperidin-1-yl]methyl]-3-azaspiro[5.5]undecan-3-yl]-4-fluoro-2-methylbenzaldehyde |
| SMILES | Cc1cc(F)c(N2CCC3(CCC(CN4CCC(SN5CCC(N)CC5)CC4)CC3)CC2)cc1C=O |
| InChI | InChI=1S/C29H45FN4OS/c1-22-18-27(30)28(19-24(22)21-35)33-16-10-29(11-17-33)8-2-23(3-9-29)20-32-12-6-26(7-13-32)36-34-14-4-25(31)5-15-34/h18-19,21,23,25-26H,2-17,20,31H2,1H3 |
| InChIKey | QCHZXOBERNBAOW-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 52.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.77 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|