C30H43FN6O5S — CID 169258009
5-[4-[4-(4-aminopiperidin-1-yl)sulfanylpiperidine-1-carbonyl]piperidin-1-yl]-4-fluoro-2-formyl-N-methyl-N'-(5-oxopentanoyl)benzohydrazide (PubChem CID 169258009) has the molecular formula C30H43FN6O5S and a molecular weight of 618.78 g/mol. Its IUPAC name is 5-[4-[4-(4-aminopiperidin-1-yl)sulfanylpiperidine-1-carbonyl]piperidin-1-yl]-4-fluoro-2-formyl-N-methyl-N'-(5-oxopentanoyl)benzohydrazide.
| Compound Name | 5-[4-[4-(4-aminopiperidin-1-yl)sulfanylpiperidine-1-carbonyl]piperidin-1-yl]-4-fluoro-2-formyl-N-methyl-N'-(5-oxopentanoyl)benzohydrazide |
|---|---|
| PubChem CID | 169258009 |
| Molecular Formula | C30H43FN6O5S |
| Molecular Weight | 618.78 g/mol |
| Exact Mass | 618.30 |
| IUPAC Name | 5-[4-[4-(4-aminopiperidin-1-yl)sulfanylpiperidine-1-carbonyl]piperidin-1-yl]-4-fluoro-2-formyl-N-methyl-N'-(5-oxopentanoyl)benzohydrazide |
| SMILES | CN(NC(=O)CCCC=O)C(=O)c1cc(N2CCC(C(=O)N3CCC(SN4CCC(N)CC4)CC3)CC2)c(F)cc1C=O |
| InChI | InChI=1S/C30H43FN6O5S/c1-34(33-28(40)4-2-3-17-38)30(42)25-19-27(26(31)18-22(25)20-39)35-11-5-21(6-12-35)29(41)36-13-9-24(10-14-36)43-37-15-7-23(32)8-16-37/h17-21,23-24H,2-16,32H2,1H3,(H,33,40) |
| InChIKey | UXRJVSGMNUQEBH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 136.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.78 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|