C18H14I2P2 — CID 169258535
[3-iodo-4-[3-iodo-4-(4-phosphanylphenyl)phenyl]phenyl]phosphane (PubChem CID 169258535) has the molecular formula C18H14I2P2 and a molecular weight of 546.07 g/mol. Its IUPAC name is [3-iodo-4-[3-iodo-4-(4-phosphanylphenyl)phenyl]phenyl]phosphane.
| Compound Name | [3-iodo-4-[3-iodo-4-(4-phosphanylphenyl)phenyl]phenyl]phosphane |
|---|---|
| PubChem CID | 169258535 |
| Molecular Formula | C18H14I2P2 |
| Molecular Weight | 546.07 g/mol |
| Exact Mass | 545.87 |
| IUPAC Name | [3-iodo-4-[3-iodo-4-(4-phosphanylphenyl)phenyl]phenyl]phosphane |
| SMILES | Pc1ccc(-c2ccc(-c3ccc(P)cc3I)cc2I)cc1 |
| InChI | InChI=1S/C18H14I2P2/c19-17-9-12(16-8-6-14(22)10-18(16)20)3-7-15(17)11-1-4-13(21)5-2-11/h1-10H,21-22H2 |
| InChIKey | IAHQCVOECMMKBC-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.07 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|