C41H76N2O4 — CID 169258810
decan-1-amine;methyl 2-[4-[(3S,5S,7R,10S,13R)-7-hydroxy-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoylamino]-3-methylbutanoate (PubChem CID 169258810) has the molecular formula C41H76N2O4 and a molecular weight of 661.07 g/mol. Its IUPAC name is decan-1-amine;methyl 2-[4-[(3S,5S,7R,10S,13R)-7-hydroxy-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoylamino]-3-methylbutanoate.
| Compound Name | decan-1-amine;methyl 2-[4-[(3S,5S,7R,10S,13R)-7-hydroxy-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 169258810 |
| Molecular Formula | C41H76N2O4 |
| Molecular Weight | 661.07 g/mol |
| Exact Mass | 660.58 |
| IUPAC Name | decan-1-amine;methyl 2-[4-[(3S,5S,7R,10S,13R)-7-hydroxy-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoylamino]-3-methylbutanoate |
| SMILES | CCCCCCCCCCN.COC(=O)C(NC(=O)CCC(C)C1CCC2C3C(O)C[C@@H]4C[C@@H](C)CC[C@]4(C)C3CC[C@]12C)C(C)C |
| InChI | InChI=1S/C31H53NO4.C10H23N/c1-18(2)28(29(35)36-7)32-26(34)11-8-20(4)22-9-10-23-27-24(13-15-31(22,23)6)30(5)14-12-19(3)16-21(30)17-25(27)33;1-2-3-4-5-6-7-8-9-10-11/h18-25,27-28,33H,8-17H2,1-7H3,(H,32,34);2-11H2,1H3/t19-,20?,21-,22?,23?,24?,25?,27?,28?,30-,31+;/m0./s1 |
| InChIKey | NODWVQXOYBENOD-LQAKZMCQSA-N |
| XLogP | 9.07 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.07 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|