C34H65N3O — CID 169258855
(3S,5R,10S,12S,13R)-3-[4-[4-(ethylamino)butylamino]butylamino]-10,13-dimethyl-17-pentan-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-12-ol (PubChem CID 169258855) has the molecular formula C34H65N3O and a molecular weight of 531.91 g/mol. Its IUPAC name is (3S,5R,10S,12S,13R)-3-[4-[4-(ethylamino)butylamino]butylamino]-10,13-dimethyl-17-pentan-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-12-ol.
| Compound Name | (3S,5R,10S,12S,13R)-3-[4-[4-(ethylamino)butylamino]butylamino]-10,13-dimethyl-17-pentan-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-12-ol |
|---|---|
| PubChem CID | 169258855 |
| Molecular Formula | C34H65N3O |
| Molecular Weight | 531.91 g/mol |
| Exact Mass | 531.51 |
| IUPAC Name | (3S,5R,10S,12S,13R)-3-[4-[4-(ethylamino)butylamino]butylamino]-10,13-dimethyl-17-pentan-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-12-ol |
| SMILES | CCCC(C)C1CCC2C3CC[C@@H]4C[C@@H](NCCCCNCCCCNCC)CC[C@]4(C)C3C[C@H](O)[C@]12C |
| InChI | InChI=1S/C34H65N3O/c1-6-12-25(3)29-15-16-30-28-14-13-26-23-27(37-22-11-10-21-36-20-9-8-19-35-7-2)17-18-33(26,4)31(28)24-32(38)34(29,30)5/h25-32,35-38H,6-24H2,1-5H3/t25?,26-,27+,28?,29?,30?,31?,32+,33+,34-/m1/s1 |
| InChIKey | CYSCHEYNNMFPGK-KRDRKEABSA-N |
| XLogP | 6.77 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.91 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|