C19H15ClFN3O — CID 169260673
N-[3-[(E)-2-(4-chlorophenyl)ethenyl]-1-methylpyrrolo[2,3-b]pyridin-5-yl]-2-fluoroprop-2-enamide (PubChem CID 169260673) has the molecular formula C19H15ClFN3O and a molecular weight of 355.80 g/mol. Its IUPAC name is N-[3-[(E)-2-(4-chlorophenyl)ethenyl]-1-methylpyrrolo[2,3-b]pyridin-5-yl]-2-fluoroprop-2-enamide.
| Compound Name | N-[3-[(E)-2-(4-chlorophenyl)ethenyl]-1-methylpyrrolo[2,3-b]pyridin-5-yl]-2-fluoroprop-2-enamide |
|---|---|
| PubChem CID | 169260673 |
| Molecular Formula | C19H15ClFN3O |
| Molecular Weight | 355.80 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | N-[3-[(E)-2-(4-chlorophenyl)ethenyl]-1-methylpyrrolo[2,3-b]pyridin-5-yl]-2-fluoroprop-2-enamide |
| SMILES | C=C(F)C(=O)Nc1cnc2c(c1)c(/C=C/c1ccc(Cl)cc1)cn2C |
| InChI | InChI=1S/C19H15ClFN3O/c1-12(21)19(25)23-16-9-17-14(11-24(2)18(17)22-10-16)6-3-13-4-7-15(20)8-5-13/h3-11H,1H2,2H3,(H,23,25)/b6-3+ |
| InChIKey | OYHCBVHPWSVDRY-ZZXKWVIFSA-N |
| XLogP | 4.82 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.80 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|