C14H10F3N3O3 — CID 169260952
3-[(Z)-2-(5-aminopyrazin-2-yl)-2-fluoroethenyl]-4-(difluoromethoxy)benzoic acid (PubChem CID 169260952) has the molecular formula C14H10F3N3O3 and a molecular weight of 325.25 g/mol. Its IUPAC name is 3-[(Z)-2-(5-aminopyrazin-2-yl)-2-fluoroethenyl]-4-(difluoromethoxy)benzoic acid.
| Compound Name | 3-[(Z)-2-(5-aminopyrazin-2-yl)-2-fluoroethenyl]-4-(difluoromethoxy)benzoic acid |
|---|---|
| PubChem CID | 169260952 |
| Molecular Formula | C14H10F3N3O3 |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 3-[(Z)-2-(5-aminopyrazin-2-yl)-2-fluoroethenyl]-4-(difluoromethoxy)benzoic acid |
| SMILES | Nc1cnc(/C(F)=C/c2cc(C(=O)O)ccc2OC(F)F)cn1 |
| InChI | InChI=1S/C14H10F3N3O3/c15-9(10-5-20-12(18)6-19-10)4-8-3-7(13(21)22)1-2-11(8)23-14(16)17/h1-6,14H,(H2,18,20)(H,21,22)/b9-4- |
| InChIKey | OEVBEPOGXNEHAN-WTKPLQERSA-N |
| XLogP | 2.83 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |