C22H28N4O5 — CID 169262499
N'-[2-[4-[acetyl(formyl)amino]phenyl]ethyl]-N-[2-(4-aminophenyl)ethyl]oxamide;methanol (PubChem CID 169262499) has the molecular formula C22H28N4O5 and a molecular weight of 428.49 g/mol. Its IUPAC name is N'-[2-[4-[acetyl(formyl)amino]phenyl]ethyl]-N-[2-(4-aminophenyl)ethyl]oxamide;methanol.
| Compound Name | N'-[2-[4-[acetyl(formyl)amino]phenyl]ethyl]-N-[2-(4-aminophenyl)ethyl]oxamide;methanol |
|---|---|
| PubChem CID | 169262499 |
| Molecular Formula | C22H28N4O5 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | N'-[2-[4-[acetyl(formyl)amino]phenyl]ethyl]-N-[2-(4-aminophenyl)ethyl]oxamide;methanol |
| SMILES | CC(=O)N(C=O)c1ccc(CCNC(=O)C(=O)NCCc2ccc(N)cc2)cc1.CO |
| InChI | InChI=1S/C21H24N4O4.CH4O/c1-15(27)25(14-26)19-8-4-17(5-9-19)11-13-24-21(29)20(28)23-12-10-16-2-6-18(22)7-3-16;1-2/h2-9,14H,10-13,22H2,1H3,(H,23,28)(H,24,29);2H,1H3 |
| InChIKey | KURAMAYJAPWXTP-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 141.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|