C29H39N5O4 — CID 169263396
1-benzyl-3-[4-[2-cyclohexyl-3-(2-hydroxyethyl)imidazol-4-yl]phenyl]urea;propan-2-yl carbamate (PubChem CID 169263396) has the molecular formula C29H39N5O4 and a molecular weight of 521.66 g/mol. Its IUPAC name is 1-benzyl-3-[4-[2-cyclohexyl-3-(2-hydroxyethyl)imidazol-4-yl]phenyl]urea;propan-2-yl carbamate.
| Compound Name | 1-benzyl-3-[4-[2-cyclohexyl-3-(2-hydroxyethyl)imidazol-4-yl]phenyl]urea;propan-2-yl carbamate |
|---|---|
| PubChem CID | 169263396 |
| Molecular Formula | C29H39N5O4 |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.30 |
| IUPAC Name | 1-benzyl-3-[4-[2-cyclohexyl-3-(2-hydroxyethyl)imidazol-4-yl]phenyl]urea;propan-2-yl carbamate |
| SMILES | CC(C)OC(N)=O.O=C(NCc1ccccc1)Nc1ccc(-c2cnc(C3CCCCC3)n2CCO)cc1 |
| InChI | InChI=1S/C25H30N4O2.C4H9NO2/c30-16-15-29-23(18-26-24(29)21-9-5-2-6-10-21)20-11-13-22(14-12-20)28-25(31)27-17-19-7-3-1-4-8-19;1-3(2)7-4(5)6/h1,3-4,7-8,11-14,18,21,30H,2,5-6,9-10,15-17H2,(H2,27,28,31);3H,1-2H3,(H2,5,6) |
| InChIKey | IQTKSYIKMFQBJF-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 131.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |