C24H16FN5O2 — CID 169263927
(6E)-3-[(4-fluorophenyl)methylamino]-6-methoxyimino-12-oxoindolo[2,1-b]quinazoline-8-carbonitrile (PubChem CID 169263927) has the molecular formula C24H16FN5O2 and a molecular weight of 425.42 g/mol. Its IUPAC name is (6E)-3-[(4-fluorophenyl)methylamino]-6-methoxyimino-12-oxoindolo[2,1-b]quinazoline-8-carbonitrile.
| Compound Name | (6E)-3-[(4-fluorophenyl)methylamino]-6-methoxyimino-12-oxoindolo[2,1-b]quinazoline-8-carbonitrile |
|---|---|
| PubChem CID | 169263927 |
| Molecular Formula | C24H16FN5O2 |
| Molecular Weight | 425.42 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | (6E)-3-[(4-fluorophenyl)methylamino]-6-methoxyimino-12-oxoindolo[2,1-b]quinazoline-8-carbonitrile |
| SMILES | CO/N=C1\c2cc(C#N)ccc2-n2c1nc1cc(NCc3ccc(F)cc3)ccc1c2=O |
| InChI | InChI=1S/C24H16FN5O2/c1-32-29-22-19-10-15(12-26)4-9-21(19)30-23(22)28-20-11-17(7-8-18(20)24(30)31)27-13-14-2-5-16(25)6-3-14/h2-11,27H,13H2,1H3/b29-22+ |
| InChIKey | YXZAUWSTYMBQAZ-QUPMIFSKSA-N |
| XLogP | 3.72 |
| TPSA | 92.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|