C30H29ClF5N5O3 — CID 169264668
4-amino-N-[2-[4-(2-amino-1,1-difluoro-2-oxoethyl)-6-(3-chloro-2,4-difluorophenyl)-5-fluoro-2-pyridinyl]pentyl]-3-(cyclopropyliminomethyl)-5-methoxybenzamide (PubChem CID 169264668) has the molecular formula C30H29ClF5N5O3 and a molecular weight of 638.04 g/mol. Its IUPAC name is 4-amino-N-[2-[4-(2-amino-1,1-difluoro-2-oxoethyl)-6-(3-chloro-2,4-difluorophenyl)-5-fluoro-2-pyridinyl]pentyl]-3-(cyclopropyliminomethyl)-5-methoxybenzamide.
| Compound Name | 4-amino-N-[2-[4-(2-amino-1,1-difluoro-2-oxoethyl)-6-(3-chloro-2,4-difluorophenyl)-5-fluoro-2-pyridinyl]pentyl]-3-(cyclopropyliminomethyl)-5-methoxybenzamide |
|---|---|
| PubChem CID | 169264668 |
| Molecular Formula | C30H29ClF5N5O3 |
| Molecular Weight | 638.04 g/mol |
| Exact Mass | 637.19 |
| IUPAC Name | 4-amino-N-[2-[4-(2-amino-1,1-difluoro-2-oxoethyl)-6-(3-chloro-2,4-difluorophenyl)-5-fluoro-2-pyridinyl]pentyl]-3-(cyclopropyliminomethyl)-5-methoxybenzamide |
| SMILES | CCCC(CNC(=O)c1cc(/C=N/C2CC2)c(N)c(OC)c1)c1cc(C(F)(F)C(N)=O)c(F)c(-c2ccc(F)c(Cl)c2F)n1 |
| InChI | InChI=1S/C30H29ClF5N5O3/c1-3-4-14(12-40-28(42)15-9-16(13-39-17-5-6-17)26(37)22(10-15)44-2)21-11-19(30(35,36)29(38)43)25(34)27(41-21)18-7-8-20(32)23(31)24(18)33/h7-11,13-14,17H,3-6,12,37H2,1-2H3,(H2,38,43)(H,40,42)/b39-13+ |
| InChIKey | CTWDWIQSFUZJJJ-BUADGAHVSA-N |
| XLogP | 5.88 |
| TPSA | 132.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.04 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|