C32H29ClF3N5O3 — CID 169264815
6-[2-[[4-amino-3-methoxy-5-(propyliminomethyl)benzoyl]amino]-1-phenylethyl]-2-(5-chloro-2,4-difluorophenyl)-3-fluoropyridine-4-carboxamide (PubChem CID 169264815) has the molecular formula C32H29ClF3N5O3 and a molecular weight of 624.06 g/mol. Its IUPAC name is 6-[2-[[4-amino-3-methoxy-5-(propyliminomethyl)benzoyl]amino]-1-phenylethyl]-2-(5-chloro-2,4-difluorophenyl)-3-fluoropyridine-4-carboxamide.
| Compound Name | 6-[2-[[4-amino-3-methoxy-5-(propyliminomethyl)benzoyl]amino]-1-phenylethyl]-2-(5-chloro-2,4-difluorophenyl)-3-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 169264815 |
| Molecular Formula | C32H29ClF3N5O3 |
| Molecular Weight | 624.06 g/mol |
| Exact Mass | 623.19 |
| IUPAC Name | 6-[2-[[4-amino-3-methoxy-5-(propyliminomethyl)benzoyl]amino]-1-phenylethyl]-2-(5-chloro-2,4-difluorophenyl)-3-fluoropyridine-4-carboxamide |
| SMILES | CCC/N=C/c1cc(C(=O)NCC(c2ccccc2)c2cc(C(N)=O)c(F)c(-c3cc(Cl)c(F)cc3F)n2)cc(OC)c1N |
| InChI | InChI=1S/C32H29ClF3N5O3/c1-3-9-39-15-19-10-18(11-27(44-2)29(19)37)32(43)40-16-22(17-7-5-4-6-8-17)26-13-21(31(38)42)28(36)30(41-26)20-12-23(33)25(35)14-24(20)34/h4-8,10-15,22H,3,9,16,37H2,1-2H3,(H2,38,42)(H,40,43)/b39-15+ |
| InChIKey | BMHQMUTZYYUQAB-AATKOCIRSA-N |
| XLogP | 5.90 |
| TPSA | 132.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.06 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|