C34H33Cl2FN4O3 — CID 169264941
4-amino-3-(cyclopropyliminomethyl)-N-[(2R)-2-[6-(2,3-dichloro-4-fluorophenyl)-4-(2-hydroxypropan-2-yl)-2-pyridinyl]-2-phenylethyl]-5-methoxybenzamide (PubChem CID 169264941) has the molecular formula C34H33Cl2FN4O3 and a molecular weight of 635.57 g/mol. Its IUPAC name is 4-amino-3-(cyclopropyliminomethyl)-N-[(2R)-2-[6-(2,3-dichloro-4-fluorophenyl)-4-(2-hydroxypropan-2-yl)-2-pyridinyl]-2-phenylethyl]-5-methoxybenzamide.
| Compound Name | 4-amino-3-(cyclopropyliminomethyl)-N-[(2R)-2-[6-(2,3-dichloro-4-fluorophenyl)-4-(2-hydroxypropan-2-yl)-2-pyridinyl]-2-phenylethyl]-5-methoxybenzamide |
|---|---|
| PubChem CID | 169264941 |
| Molecular Formula | C34H33Cl2FN4O3 |
| Molecular Weight | 635.57 g/mol |
| Exact Mass | 634.19 |
| IUPAC Name | 4-amino-3-(cyclopropyliminomethyl)-N-[(2R)-2-[6-(2,3-dichloro-4-fluorophenyl)-4-(2-hydroxypropan-2-yl)-2-pyridinyl]-2-phenylethyl]-5-methoxybenzamide |
| SMILES | COc1cc(C(=O)NC[C@@H](c2ccccc2)c2cc(C(C)(C)O)cc(-c3ccc(F)c(Cl)c3Cl)n2)cc(/C=N/C2CC2)c1N |
| InChI | InChI=1S/C34H33Cl2FN4O3/c1-34(2,43)22-15-27(24-11-12-26(37)31(36)30(24)35)41-28(16-22)25(19-7-5-4-6-8-19)18-40-33(42)20-13-21(17-39-23-9-10-23)32(38)29(14-20)44-3/h4-8,11-17,23,25,43H,9-10,18,38H2,1-3H3,(H,40,42)/b39-17+/t25-/m0/s1 |
| InChIKey | CTBVGKLITMKLOM-PINBSSCOSA-N |
| XLogP | 7.16 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.57 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|