C31H30ClF3KN5O — CID 169265064
potassium [4-amino-3-(cyclopropyliminomethyl)-5-methoxyphenyl]-[2-[6-(5-chloro-2,4-difluorophenyl)-4-(1-cyanocyclopropyl)-5-fluoro-2-pyridinyl]pentyl]azanide (PubChem CID 169265064) has the molecular formula C31H30ClF3KN5O and a molecular weight of 620.16 g/mol. Its IUPAC name is potassium [4-amino-3-(cyclopropyliminomethyl)-5-methoxyphenyl]-[2-[6-(5-chloro-2,4-difluorophenyl)-4-(1-cyanocyclopropyl)-5-fluoro-2-pyridinyl]pentyl]azanide.
| Compound Name | potassium [4-amino-3-(cyclopropyliminomethyl)-5-methoxyphenyl]-[2-[6-(5-chloro-2,4-difluorophenyl)-4-(1-cyanocyclopropyl)-5-fluoro-2-pyridinyl]pentyl]azanide |
|---|---|
| PubChem CID | 169265064 |
| Molecular Formula | C31H30ClF3KN5O |
| Molecular Weight | 620.16 g/mol |
| Exact Mass | 619.17 |
| IUPAC Name | potassium [4-amino-3-(cyclopropyliminomethyl)-5-methoxyphenyl]-[2-[6-(5-chloro-2,4-difluorophenyl)-4-(1-cyanocyclopropyl)-5-fluoro-2-pyridinyl]pentyl]azanide |
| SMILES | CCCC(C[N-]c1cc(/C=N/C2CC2)c(N)c(OC)c1)c1cc(C2(C#N)CC2)c(F)c(-c2cc(Cl)c(F)cc2F)n1.[K+] |
| InChI | InChI=1S/C31H30ClF3N5O.K/c1-3-4-17(14-39-20-9-18(15-38-19-5-6-19)29(37)27(10-20)41-2)26-12-22(31(16-36)7-8-31)28(35)30(40-26)21-11-23(32)25(34)13-24(21)33;/h9-13,15,17,19H,3-8,14,37H2,1-2H3;/q-1;+1/b38-15+; |
| InChIKey | BVEJMUPODRJUBC-VSGHFWFWSA-N |
| XLogP | 5.14 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.16 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|