C33H32ClF5N4O2 — CID 169265016
2-[6-[2-[4-amino-N-fluoro-3-(3-fluoropropyliminomethyl)-5-methoxyanilino]-1-phenylethyl]-2-(5-chloro-2,4-difluorophenyl)-3-fluoro-4-pyridinyl]propan-2-ol (PubChem CID 169265016) has the molecular formula C33H32ClF5N4O2 and a molecular weight of 647.09 g/mol. Its IUPAC name is 2-[6-[2-[4-amino-N-fluoro-3-(3-fluoropropyliminomethyl)-5-methoxyanilino]-1-phenylethyl]-2-(5-chloro-2,4-difluorophenyl)-3-fluoro-4-pyridinyl]propan-2-ol.
| Compound Name | 2-[6-[2-[4-amino-N-fluoro-3-(3-fluoropropyliminomethyl)-5-methoxyanilino]-1-phenylethyl]-2-(5-chloro-2,4-difluorophenyl)-3-fluoro-4-pyridinyl]propan-2-ol |
|---|---|
| PubChem CID | 169265016 |
| Molecular Formula | C33H32ClF5N4O2 |
| Molecular Weight | 647.09 g/mol |
| Exact Mass | 646.21 |
| IUPAC Name | 2-[6-[2-[4-amino-N-fluoro-3-(3-fluoropropyliminomethyl)-5-methoxyanilino]-1-phenylethyl]-2-(5-chloro-2,4-difluorophenyl)-3-fluoro-4-pyridinyl]propan-2-ol |
| SMILES | COc1cc(N(F)CC(c2ccccc2)c2cc(C(C)(C)O)c(F)c(-c3cc(Cl)c(F)cc3F)n2)cc(/C=N/CCCF)c1N |
| InChI | InChI=1S/C33H32ClF5N4O2/c1-33(2,44)24-15-28(42-32(30(24)38)22-14-25(34)27(37)16-26(22)36)23(19-8-5-4-6-9-19)18-43(39)21-12-20(17-41-11-7-10-35)31(40)29(13-21)45-3/h4-6,8-9,12-17,23,44H,7,10-11,18,40H2,1-3H3/b41-17+ |
| InChIKey | BYTRPJDHWUUOBK-PORAZQCPSA-N |
| XLogP | 7.94 |
| TPSA | 83.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.09 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|