C34H34ClF5N4O2 — CID 169265009
N-[2-[6-(5-chloro-2,4-difluorophenyl)-5-fluoro-4-(2-fluoropropan-2-yl)-2-pyridinyl]-2-phenylethyl]formamide;2-[(E)-1-fluoroethyliminomethyl]-6-methoxy-4-methylaniline (PubChem CID 169265009) has the molecular formula C34H34ClF5N4O2 and a molecular weight of 661.12 g/mol. Its IUPAC name is N-[2-[6-(5-chloro-2,4-difluorophenyl)-5-fluoro-4-(2-fluoropropan-2-yl)-2-pyridinyl]-2-phenylethyl]formamide;2-[(E)-1-fluoroethyliminomethyl]-6-methoxy-4-methylaniline.
| Compound Name | N-[2-[6-(5-chloro-2,4-difluorophenyl)-5-fluoro-4-(2-fluoropropan-2-yl)-2-pyridinyl]-2-phenylethyl]formamide;2-[(E)-1-fluoroethyliminomethyl]-6-methoxy-4-methylaniline |
|---|---|
| PubChem CID | 169265009 |
| Molecular Formula | C34H34ClF5N4O2 |
| Molecular Weight | 661.12 g/mol |
| Exact Mass | 660.23 |
| IUPAC Name | N-[2-[6-(5-chloro-2,4-difluorophenyl)-5-fluoro-4-(2-fluoropropan-2-yl)-2-pyridinyl]-2-phenylethyl]formamide;2-[(E)-1-fluoroethyliminomethyl]-6-methoxy-4-methylaniline |
| SMILES | CC(C)(F)c1cc(C(CNC=O)c2ccccc2)nc(-c2cc(Cl)c(F)cc2F)c1F.COc1cc(C)cc(/C=N/C(C)F)c1N |
| InChI | InChI=1S/C23H19ClF4N2O.C11H15FN2O/c1-23(2,28)16-9-20(15(11-29-12-31)13-6-4-3-5-7-13)30-22(21(16)27)14-8-17(24)19(26)10-18(14)25;1-7-4-9(6-14-8(2)12)11(13)10(5-7)15-3/h3-10,12,15H,11H2,1-2H3,(H,29,31);4-6,8H,13H2,1-3H3/b;14-6+ |
| InChIKey | PFKSEEPBDKTCKA-ULYWWGBFSA-N |
| XLogP | 8.22 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.12 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|