C31H35F7N4O2 — CID 156809885
N-[2-[6-(4-fluorophenyl)-4-methyl-5-(3,3,3-trifluoropropyl)-2-pyridinyl]pentyl]formamide;4-methyl-2-(methyliminomethyl)-6-(trifluoromethoxy)aniline (PubChem CID 156809885) has the molecular formula C31H35F7N4O2 and a molecular weight of 628.63 g/mol. Its IUPAC name is N-[2-[6-(4-fluorophenyl)-4-methyl-5-(3,3,3-trifluoropropyl)-2-pyridinyl]pentyl]formamide;4-methyl-2-(methyliminomethyl)-6-(trifluoromethoxy)aniline.
| Compound Name | N-[2-[6-(4-fluorophenyl)-4-methyl-5-(3,3,3-trifluoropropyl)-2-pyridinyl]pentyl]formamide;4-methyl-2-(methyliminomethyl)-6-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 156809885 |
| Molecular Formula | C31H35F7N4O2 |
| Molecular Weight | 628.63 g/mol |
| Exact Mass | 628.26 |
| IUPAC Name | N-[2-[6-(4-fluorophenyl)-4-methyl-5-(3,3,3-trifluoropropyl)-2-pyridinyl]pentyl]formamide;4-methyl-2-(methyliminomethyl)-6-(trifluoromethoxy)aniline |
| SMILES | C/N=C/c1cc(C)cc(OC(F)(F)F)c1N.CCCC(CNC=O)c1cc(C)c(CCC(F)(F)F)c(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C21H24F4N2O.C10H11F3N2O/c1-3-4-16(12-26-13-28)19-11-14(2)18(9-10-21(23,24)25)20(27-19)15-5-7-17(22)8-6-15;1-6-3-7(5-15-2)9(14)8(4-6)16-10(11,12)13/h5-8,11,13,16H,3-4,9-10,12H2,1-2H3,(H,26,28);3-5H,14H2,1-2H3/b;15-5+ |
| InChIKey | ADEGJEWUJRMFKP-GBBWYMQHSA-N |
| XLogP | 7.85 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.63 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|