C35H35ClF4N4O — CID 169234018
4-[(Z)-1-[[2-[6-(5-chloro-2,4-difluorophenyl)-5-ethyl-4-methyl-2-pyridinyl]-2-(4-fluorophenyl)ethyl]amino]prop-1-enyl]-2-[(E)-1-fluoroethyliminomethyl]-6-methoxyaniline (PubChem CID 169234018) has the molecular formula C35H35ClF4N4O and a molecular weight of 639.14 g/mol. Its IUPAC name is 4-[(Z)-1-[[2-[6-(5-chloro-2,4-difluorophenyl)-5-ethyl-4-methyl-2-pyridinyl]-2-(4-fluorophenyl)ethyl]amino]prop-1-enyl]-2-[(E)-1-fluoroethyliminomethyl]-6-methoxyaniline.
| Compound Name | 4-[(Z)-1-[[2-[6-(5-chloro-2,4-difluorophenyl)-5-ethyl-4-methyl-2-pyridinyl]-2-(4-fluorophenyl)ethyl]amino]prop-1-enyl]-2-[(E)-1-fluoroethyliminomethyl]-6-methoxyaniline |
|---|---|
| PubChem CID | 169234018 |
| Molecular Formula | C35H35ClF4N4O |
| Molecular Weight | 639.14 g/mol |
| Exact Mass | 638.24 |
| IUPAC Name | 4-[(Z)-1-[[2-[6-(5-chloro-2,4-difluorophenyl)-5-ethyl-4-methyl-2-pyridinyl]-2-(4-fluorophenyl)ethyl]amino]prop-1-enyl]-2-[(E)-1-fluoroethyliminomethyl]-6-methoxyaniline |
| SMILES | C/C=C(\NCC(c1ccc(F)cc1)c1cc(C)c(CC)c(-c2cc(Cl)c(F)cc2F)n1)c1cc(/C=N/C(C)F)c(N)c(OC)c1 |
| InChI | InChI=1S/C35H35ClF4N4O/c1-6-25-19(3)12-32(44-35(25)26-15-28(36)30(40)16-29(26)39)27(21-8-10-24(38)11-9-21)18-43-31(7-2)22-13-23(17-42-20(4)37)34(41)33(14-22)45-5/h7-17,20,27,43H,6,18,41H2,1-5H3/b31-7-,42-17+ |
| InChIKey | YXIXSLGRZOFBPJ-VKPWWHGYSA-N |
| XLogP | 8.80 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.14 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|