C31H31ClF3N5O — CID 169265065
1-[6-[1-[4-amino-3-(cyclopropyliminomethyl)-5-methoxyanilino]pentan-2-yl]-2-(5-chloro-2,4-difluorophenyl)-3-fluoro-4-pyridinyl]cyclopropane-1-carbonitrile (PubChem CID 169265065) has the molecular formula C31H31ClF3N5O and a molecular weight of 582.07 g/mol. Its IUPAC name is 1-[6-[1-[4-amino-3-(cyclopropyliminomethyl)-5-methoxyanilino]pentan-2-yl]-2-(5-chloro-2,4-difluorophenyl)-3-fluoro-4-pyridinyl]cyclopropane-1-carbonitrile.
| Compound Name | 1-[6-[1-[4-amino-3-(cyclopropyliminomethyl)-5-methoxyanilino]pentan-2-yl]-2-(5-chloro-2,4-difluorophenyl)-3-fluoro-4-pyridinyl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 169265065 |
| Molecular Formula | C31H31ClF3N5O |
| Molecular Weight | 582.07 g/mol |
| Exact Mass | 581.22 |
| IUPAC Name | 1-[6-[1-[4-amino-3-(cyclopropyliminomethyl)-5-methoxyanilino]pentan-2-yl]-2-(5-chloro-2,4-difluorophenyl)-3-fluoro-4-pyridinyl]cyclopropane-1-carbonitrile |
| SMILES | CCCC(CNc1cc(/C=N/C2CC2)c(N)c(OC)c1)c1cc(C2(C#N)CC2)c(F)c(-c2cc(Cl)c(F)cc2F)n1 |
| InChI | InChI=1S/C31H31ClF3N5O/c1-3-4-17(14-39-20-9-18(15-38-19-5-6-19)29(37)27(10-20)41-2)26-12-22(31(16-36)7-8-31)28(35)30(40-26)21-11-23(32)25(34)13-24(21)33/h9-13,15,17,19,39H,3-8,14,37H2,1-2H3/b38-15+ |
| InChIKey | QUXRZUMZMVIXFM-DVRIZHICSA-N |
| XLogP | 7.54 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.07 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|